About 1-butyl-4-(1-chloroethyl)-3,5-diethylpyrazole
1-butyl-4-(1-chloroethyl)-3,5-diethylpyrazole (PubChem CID 82699491) has the molecular formula C13H23ClN2
and a molecular weight of 242.79 g/mol. Its IUPAC name is 1-butyl-4-(1-chloroethyl)-3,5-diethylpyrazole.
Molecular Properties
| Compound Name | 1-butyl-4-(1-chloroethyl)-3,5-diethylpyrazole |
| PubChem CID | 82699491 |
| Molecular Formula | C13H23ClN2 |
| Molecular Weight | 242.79 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 1-butyl-4-(1-chloroethyl)-3,5-diethylpyrazole |
| SMILES | CCCCn1nc(CC)c(C(C)Cl)c1CC |
| InChI | InChI=1S/C13H23ClN2/c1-5-8-9-16-12(7-3)13(10(4)14)11(6-2)15-16/h10H,5-9H2,1-4H3 |
| InChIKey | MFVFHBBCCNQZKF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.79 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-4-(1-chloroethyl)-3,5-diethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-4-(1-chloroethyl)-3,5-diethylpyrazole?
The IUPAC name of 1-butyl-4-(1-chloroethyl)-3,5-diethylpyrazole (CID 82699491) is 1-butyl-4-(1-chloroethyl)-3,5-diethylpyrazole.
What is the SMILES notation for 1-butyl-4-(1-chloroethyl)-3,5-diethylpyrazole?
The canonical SMILES for 1-butyl-4-(1-chloroethyl)-3,5-diethylpyrazole is CCCCn1nc(CC)c(C(C)Cl)c1CC.
What is the InChIKey of 1-butyl-4-(1-chloroethyl)-3,5-diethylpyrazole?
The InChIKey is MFVFHBBCCNQZKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23ClN2/c1-5-8-9-16-12(7-3)13(10(4)14)11(6-2)15-16/h10H,5-9H2,1-4H3.
What are the key properties of 1-butyl-4-(1-chloroethyl)-3,5-diethylpyrazole?
1-butyl-4-(1-chloroethyl)-3,5-diethylpyrazole has a molecular weight of 242.79 g/mol, XLogP of 4.11, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4-(1-chloroethyl)-3,5-diethylpyrazole is sourced from PubChem (CID 82699491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).