C17H23ClN2 — CID 82699922
4-(chloromethyl)-3,5-diethyl-1-[(4-ethylphenyl)methyl]pyrazole (PubChem CID 82699922) has the molecular formula C17H23ClN2 and a molecular weight of 290.84 g/mol. Its IUPAC name is 4-(chloromethyl)-3,5-diethyl-1-[(4-ethylphenyl)methyl]pyrazole.
| Compound Name | 4-(chloromethyl)-3,5-diethyl-1-[(4-ethylphenyl)methyl]pyrazole |
|---|---|
| PubChem CID | 82699922 |
| Molecular Formula | C17H23ClN2 |
| Molecular Weight | 290.84 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 4-(chloromethyl)-3,5-diethyl-1-[(4-ethylphenyl)methyl]pyrazole |
| SMILES | CCc1ccc(Cn2nc(CC)c(CCl)c2CC)cc1 |
| InChI | InChI=1S/C17H23ClN2/c1-4-13-7-9-14(10-8-13)12-20-17(6-3)15(11-18)16(5-2)19-20/h7-10H,4-6,11-12H2,1-3H3 |
| InChIKey | ZFFQQDLIMZACRS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.84 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|