About 1-butyl-3,5-diethylpyrazole-4-sulfonamide
1-butyl-3,5-diethylpyrazole-4-sulfonamide (PubChem CID 82700722) has the molecular formula C11H21N3O2S
and a molecular weight of 259.37 g/mol. Its IUPAC name is 1-butyl-3,5-diethylpyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | 1-butyl-3,5-diethylpyrazole-4-sulfonamide |
| PubChem CID | 82700722 |
| Molecular Formula | C11H21N3O2S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 1-butyl-3,5-diethylpyrazole-4-sulfonamide |
| SMILES | CCCCn1nc(CC)c(S(N)(=O)=O)c1CC |
| InChI | InChI=1S/C11H21N3O2S/c1-4-7-8-14-10(6-3)11(17(12,15)16)9(5-2)13-14/h4-8H2,1-3H3,(H2,12,15,16) |
| InChIKey | ZLHFSTYVOLECJU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-butyl-3,5-diethylpyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3,5-diethylpyrazole-4-sulfonamide?
The IUPAC name of 1-butyl-3,5-diethylpyrazole-4-sulfonamide (CID 82700722) is 1-butyl-3,5-diethylpyrazole-4-sulfonamide.
What is the SMILES notation for 1-butyl-3,5-diethylpyrazole-4-sulfonamide?
The canonical SMILES for 1-butyl-3,5-diethylpyrazole-4-sulfonamide is CCCCn1nc(CC)c(S(N)(=O)=O)c1CC.
What is the InChIKey of 1-butyl-3,5-diethylpyrazole-4-sulfonamide?
The InChIKey is ZLHFSTYVOLECJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O2S/c1-4-7-8-14-10(6-3)11(17(12,15)16)9(5-2)13-14/h4-8H2,1-3H3,(H2,12,15,16).
What are the key properties of 1-butyl-3,5-diethylpyrazole-4-sulfonamide?
1-butyl-3,5-diethylpyrazole-4-sulfonamide has a molecular weight of 259.37 g/mol, XLogP of 1.46, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3,5-diethylpyrazole-4-sulfonamide is sourced from PubChem (CID 82700722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).