C13H21BrN4O — CID 82701666
4-[4-(2-bromoethoxy)piperidin-1-yl]-N,N-dimethylpyrimidin-2-amine (PubChem CID 82701666) has the molecular formula C13H21BrN4O and a molecular weight of 329.24 g/mol. Its IUPAC name is 4-[4-(2-bromoethoxy)piperidin-1-yl]-N,N-dimethylpyrimidin-2-amine.
| Compound Name | 4-[4-(2-bromoethoxy)piperidin-1-yl]-N,N-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 82701666 |
| Molecular Formula | C13H21BrN4O |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 4-[4-(2-bromoethoxy)piperidin-1-yl]-N,N-dimethylpyrimidin-2-amine |
| SMILES | CN(C)c1nccc(N2CCC(OCCBr)CC2)n1 |
| InChI | InChI=1S/C13H21BrN4O/c1-17(2)13-15-7-3-12(16-13)18-8-4-11(5-9-18)19-10-6-14/h3,7,11H,4-6,8-10H2,1-2H3 |
| InChIKey | WAJNMUXIOBGZGD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|