C12H20ClN3OS — CID 82701825
5-[4-(2-chloroethoxy)piperidin-1-yl]-3-propan-2-yl-1,2,4-thiadiazole (PubChem CID 82701825) has the molecular formula C12H20ClN3OS and a molecular weight of 289.83 g/mol. Its IUPAC name is 5-[4-(2-chloroethoxy)piperidin-1-yl]-3-propan-2-yl-1,2,4-thiadiazole.
| Compound Name | 5-[4-(2-chloroethoxy)piperidin-1-yl]-3-propan-2-yl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 82701825 |
| Molecular Formula | C12H20ClN3OS |
| Molecular Weight | 289.83 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 5-[4-(2-chloroethoxy)piperidin-1-yl]-3-propan-2-yl-1,2,4-thiadiazole |
| SMILES | CC(C)c1nsc(N2CCC(OCCCl)CC2)n1 |
| InChI | InChI=1S/C12H20ClN3OS/c1-9(2)11-14-12(18-15-11)16-6-3-10(4-7-16)17-8-5-13/h9-10H,3-8H2,1-2H3 |
| InChIKey | PGFUYOXIKSKEPT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.83 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|