About 1-[(4-bromophenyl)methyl]-3,5-diethyl-4-iodopyrazole
1-[(4-bromophenyl)methyl]-3,5-diethyl-4-iodopyrazole (PubChem CID 82702243) has the molecular formula C14H16BrIN2
and a molecular weight of 419.10 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-3,5-diethyl-4-iodopyrazole.
Molecular Properties
| Compound Name | 1-[(4-bromophenyl)methyl]-3,5-diethyl-4-iodopyrazole |
| PubChem CID | 82702243 |
| Molecular Formula | C14H16BrIN2 |
| Molecular Weight | 419.10 g/mol |
| Exact Mass | 417.95 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-3,5-diethyl-4-iodopyrazole |
| SMILES | CCc1nn(Cc2ccc(Br)cc2)c(CC)c1I |
| InChI | InChI=1S/C14H16BrIN2/c1-3-12-14(16)13(4-2)18(17-12)9-10-5-7-11(15)8-6-10/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | QXEWFAYWPSFCFZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.10 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4-bromophenyl)methyl]-3,5-diethyl-4-iodopyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-bromophenyl)methyl]-3,5-diethyl-4-iodopyrazole?
The IUPAC name of 1-[(4-bromophenyl)methyl]-3,5-diethyl-4-iodopyrazole (CID 82702243) is 1-[(4-bromophenyl)methyl]-3,5-diethyl-4-iodopyrazole.
What is the SMILES notation for 1-[(4-bromophenyl)methyl]-3,5-diethyl-4-iodopyrazole?
The canonical SMILES for 1-[(4-bromophenyl)methyl]-3,5-diethyl-4-iodopyrazole is CCc1nn(Cc2ccc(Br)cc2)c(CC)c1I.
What is the InChIKey of 1-[(4-bromophenyl)methyl]-3,5-diethyl-4-iodopyrazole?
The InChIKey is QXEWFAYWPSFCFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16BrIN2/c1-3-12-14(16)13(4-2)18(17-12)9-10-5-7-11(15)8-6-10/h5-8H,3-4,9H2,1-2H3.
What are the key properties of 1-[(4-bromophenyl)methyl]-3,5-diethyl-4-iodopyrazole?
1-[(4-bromophenyl)methyl]-3,5-diethyl-4-iodopyrazole has a molecular weight of 419.10 g/mol, XLogP of 4.42, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-bromophenyl)methyl]-3,5-diethyl-4-iodopyrazole is sourced from PubChem (CID 82702243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).