About 3-[(4-amino-3,5-diethylpyrazol-1-yl)methyl]-5-fluorobenzonitrile
3-[(4-amino-3,5-diethylpyrazol-1-yl)methyl]-5-fluorobenzonitrile (PubChem CID 82702376) has the molecular formula C15H17FN4
and a molecular weight of 272.33 g/mol. Its IUPAC name is 3-[(4-amino-3,5-diethylpyrazol-1-yl)methyl]-5-fluorobenzonitrile.
Molecular Properties
| Compound Name | 3-[(4-amino-3,5-diethylpyrazol-1-yl)methyl]-5-fluorobenzonitrile |
| PubChem CID | 82702376 |
| Molecular Formula | C15H17FN4 |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 3-[(4-amino-3,5-diethylpyrazol-1-yl)methyl]-5-fluorobenzonitrile |
| SMILES | CCc1nn(Cc2cc(F)cc(C#N)c2)c(CC)c1N |
| InChI | InChI=1S/C15H17FN4/c1-3-13-15(18)14(4-2)20(19-13)9-11-5-10(8-17)6-12(16)7-11/h5-7H,3-4,9,18H2,1-2H3 |
| InChIKey | FYUVRGUHCDBJAW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(4-amino-3,5-diethylpyrazol-1-yl)methyl]-5-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-amino-3,5-diethylpyrazol-1-yl)methyl]-5-fluorobenzonitrile?
The IUPAC name of 3-[(4-amino-3,5-diethylpyrazol-1-yl)methyl]-5-fluorobenzonitrile (CID 82702376) is 3-[(4-amino-3,5-diethylpyrazol-1-yl)methyl]-5-fluorobenzonitrile.
What is the SMILES notation for 3-[(4-amino-3,5-diethylpyrazol-1-yl)methyl]-5-fluorobenzonitrile?
The canonical SMILES for 3-[(4-amino-3,5-diethylpyrazol-1-yl)methyl]-5-fluorobenzonitrile is CCc1nn(Cc2cc(F)cc(C#N)c2)c(CC)c1N.
What is the InChIKey of 3-[(4-amino-3,5-diethylpyrazol-1-yl)methyl]-5-fluorobenzonitrile?
The InChIKey is FYUVRGUHCDBJAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17FN4/c1-3-13-15(18)14(4-2)20(19-13)9-11-5-10(8-17)6-12(16)7-11/h5-7H,3-4,9,18H2,1-2H3.
What are the key properties of 3-[(4-amino-3,5-diethylpyrazol-1-yl)methyl]-5-fluorobenzonitrile?
3-[(4-amino-3,5-diethylpyrazol-1-yl)methyl]-5-fluorobenzonitrile has a molecular weight of 272.33 g/mol, XLogP of 2.65, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-amino-3,5-diethylpyrazol-1-yl)methyl]-5-fluorobenzonitrile is sourced from PubChem (CID 82702376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).