About [3-(3,5-diethyl-1-methylpyrazol-4-yl)-4-fluorophenyl]methanamine
[3-(3,5-diethyl-1-methylpyrazol-4-yl)-4-fluorophenyl]methanamine (PubChem CID 82703216) has the molecular formula C15H20FN3
and a molecular weight of 261.34 g/mol. Its IUPAC name is [3-(3,5-diethyl-1-methylpyrazol-4-yl)-4-fluorophenyl]methanamine.
Molecular Properties
| Compound Name | [3-(3,5-diethyl-1-methylpyrazol-4-yl)-4-fluorophenyl]methanamine |
| PubChem CID | 82703216 |
| Molecular Formula | C15H20FN3 |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | [3-(3,5-diethyl-1-methylpyrazol-4-yl)-4-fluorophenyl]methanamine |
| SMILES | CCc1nn(C)c(CC)c1-c1cc(CN)ccc1F |
| InChI | InChI=1S/C15H20FN3/c1-4-13-15(14(5-2)19(3)18-13)11-8-10(9-17)6-7-12(11)16/h6-8H,4-5,9,17H2,1-3H3 |
| InChIKey | HVEBDBNVBPRUOB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(3,5-diethyl-1-methylpyrazol-4-yl)-4-fluorophenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3,5-diethyl-1-methylpyrazol-4-yl)-4-fluorophenyl]methanamine?
The IUPAC name of [3-(3,5-diethyl-1-methylpyrazol-4-yl)-4-fluorophenyl]methanamine (CID 82703216) is [3-(3,5-diethyl-1-methylpyrazol-4-yl)-4-fluorophenyl]methanamine.
What is the SMILES notation for [3-(3,5-diethyl-1-methylpyrazol-4-yl)-4-fluorophenyl]methanamine?
The canonical SMILES for [3-(3,5-diethyl-1-methylpyrazol-4-yl)-4-fluorophenyl]methanamine is CCc1nn(C)c(CC)c1-c1cc(CN)ccc1F.
What is the InChIKey of [3-(3,5-diethyl-1-methylpyrazol-4-yl)-4-fluorophenyl]methanamine?
The InChIKey is HVEBDBNVBPRUOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20FN3/c1-4-13-15(14(5-2)19(3)18-13)11-8-10(9-17)6-7-12(11)16/h6-8H,4-5,9,17H2,1-3H3.
What are the key properties of [3-(3,5-diethyl-1-methylpyrazol-4-yl)-4-fluorophenyl]methanamine?
[3-(3,5-diethyl-1-methylpyrazol-4-yl)-4-fluorophenyl]methanamine has a molecular weight of 261.34 g/mol, XLogP of 2.81, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3,5-diethyl-1-methylpyrazol-4-yl)-4-fluorophenyl]methanamine is sourced from PubChem (CID 82703216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).