About N-(2-chloro-4,6-dimethylphenyl)-2-[(2S)-2-methylpiperazin-1-yl]acetamide
N-(2-chloro-4,6-dimethylphenyl)-2-[(2S)-2-methylpiperazin-1-yl]acetamide (PubChem CID 82704766) has the molecular formula C15H22ClN3O
and a molecular weight of 295.81 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-2-[(2S)-2-methylpiperazin-1-yl]acetamide.
Molecular Properties
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-2-[(2S)-2-methylpiperazin-1-yl]acetamide |
| PubChem CID | 82704766 |
| Molecular Formula | C15H22ClN3O |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-2-[(2S)-2-methylpiperazin-1-yl]acetamide |
| SMILES | Cc1cc(C)c(NC(=O)CN2CCNC[C@@H]2C)c(Cl)c1 |
| InChI | InChI=1S/C15H22ClN3O/c1-10-6-11(2)15(13(16)7-10)18-14(20)9-19-5-4-17-8-12(19)3/h6-7,12,17H,4-5,8-9H2,1-3H3,(H,18,20)/t12-/m0/s1 |
| InChIKey | CJDZKYJCKUOWTP-LBPRGKRZSA-N |
| XLogP | 2.19 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-chloro-4,6-dimethylphenyl)-2-[(2S)-2-methylpiperazin-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloro-4,6-dimethylphenyl)-2-[(2S)-2-methylpiperazin-1-yl]acetamide?
The IUPAC name of N-(2-chloro-4,6-dimethylphenyl)-2-[(2S)-2-methylpiperazin-1-yl]acetamide (CID 82704766) is N-(2-chloro-4,6-dimethylphenyl)-2-[(2S)-2-methylpiperazin-1-yl]acetamide.
What is the SMILES notation for N-(2-chloro-4,6-dimethylphenyl)-2-[(2S)-2-methylpiperazin-1-yl]acetamide?
The canonical SMILES for N-(2-chloro-4,6-dimethylphenyl)-2-[(2S)-2-methylpiperazin-1-yl]acetamide is Cc1cc(C)c(NC(=O)CN2CCNC[C@@H]2C)c(Cl)c1.
What is the InChIKey of N-(2-chloro-4,6-dimethylphenyl)-2-[(2S)-2-methylpiperazin-1-yl]acetamide?
The InChIKey is CJDZKYJCKUOWTP-LBPRGKRZSA-N. The full InChI is InChI=1S/C15H22ClN3O/c1-10-6-11(2)15(13(16)7-10)18-14(20)9-19-5-4-17-8-12(19)3/h6-7,12,17H,4-5,8-9H2,1-3H3,(H,18,20)/t12-/m0/s1.
What are the key properties of N-(2-chloro-4,6-dimethylphenyl)-2-[(2S)-2-methylpiperazin-1-yl]acetamide?
N-(2-chloro-4,6-dimethylphenyl)-2-[(2S)-2-methylpiperazin-1-yl]acetamide has a molecular weight of 295.81 g/mol, XLogP of 2.19, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloro-4,6-dimethylphenyl)-2-[(2S)-2-methylpiperazin-1-yl]acetamide is sourced from PubChem (CID 82704766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).