C15H17N3O2 — CID 82704916
4-[(2R)-2-methylpiperazine-1-carbonyl]-1H-quinolin-2-one (PubChem CID 82704916) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 4-[(2R)-2-methylpiperazine-1-carbonyl]-1H-quinolin-2-one.
| Compound Name | 4-[(2R)-2-methylpiperazine-1-carbonyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 82704916 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 4-[(2R)-2-methylpiperazine-1-carbonyl]-1H-quinolin-2-one |
| SMILES | C[C@@H]1CNCCN1C(=O)c1cc(=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C15H17N3O2/c1-10-9-16-6-7-18(10)15(20)12-8-14(19)17-13-5-3-2-4-11(12)13/h2-5,8,10,16H,6-7,9H2,1H3,(H,17,19)/t10-/m1/s1 |
| InChIKey | POHVJZPCZYQAOV-SNVBAGLBSA-N |
| XLogP | 0.96 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |