About 2-chloro-N-methoxy-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine
2-chloro-N-methoxy-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine (PubChem CID 82706025) has the molecular formula C8H10ClNOS
and a molecular weight of 203.69 g/mol. Its IUPAC name is 2-chloro-N-methoxy-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine.
Molecular Properties
| Compound Name | 2-chloro-N-methoxy-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine |
| PubChem CID | 82706025 |
| Molecular Formula | C8H10ClNOS |
| Molecular Weight | 203.69 g/mol |
| Exact Mass | 203.02 |
| IUPAC Name | 2-chloro-N-methoxy-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine |
| SMILES | CONC1CCc2sc(Cl)cc21 |
| InChI | InChI=1S/C8H10ClNOS/c1-11-10-6-2-3-7-5(6)4-8(9)12-7/h4,6,10H,2-3H2,1H3 |
| InChIKey | PBGCGHRHYSWONS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.69 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-methoxy-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-methoxy-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine?
The IUPAC name of 2-chloro-N-methoxy-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine (CID 82706025) is 2-chloro-N-methoxy-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine.
What is the SMILES notation for 2-chloro-N-methoxy-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine?
The canonical SMILES for 2-chloro-N-methoxy-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine is CONC1CCc2sc(Cl)cc21.
What is the InChIKey of 2-chloro-N-methoxy-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine?
The InChIKey is PBGCGHRHYSWONS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClNOS/c1-11-10-6-2-3-7-5(6)4-8(9)12-7/h4,6,10H,2-3H2,1H3.
What are the key properties of 2-chloro-N-methoxy-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine?
2-chloro-N-methoxy-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine has a molecular weight of 203.69 g/mol, XLogP of 2.54, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-methoxy-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine is sourced from PubChem (CID 82706025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).