C13H14BrN3O — CID 82706059
N-(2-bromo-5-methylphenyl)-1,5-dimethylpyrazole-4-carboxamide (PubChem CID 82706059) has the molecular formula C13H14BrN3O and a molecular weight of 308.18 g/mol. Its IUPAC name is N-(2-bromo-5-methylphenyl)-1,5-dimethylpyrazole-4-carboxamide.
| Compound Name | N-(2-bromo-5-methylphenyl)-1,5-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 82706059 |
| Molecular Formula | C13H14BrN3O |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | N-(2-bromo-5-methylphenyl)-1,5-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1ccc(Br)c(NC(=O)c2cnn(C)c2C)c1 |
| InChI | InChI=1S/C13H14BrN3O/c1-8-4-5-11(14)12(6-8)16-13(18)10-7-15-17(3)9(10)2/h4-7H,1-3H3,(H,16,18) |
| InChIKey | UKQSSKZTUCTWCH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |