C6H6F3N3O5S — CID 82706093
5-(2,2,2-trifluoroethoxysulfamoyl)-1H-pyrazole-4-carboxylic acid (PubChem CID 82706093) has the molecular formula C6H6F3N3O5S and a molecular weight of 289.19 g/mol. Its IUPAC name is 5-(2,2,2-trifluoroethoxysulfamoyl)-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-(2,2,2-trifluoroethoxysulfamoyl)-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82706093 |
| Molecular Formula | C6H6F3N3O5S |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | 5-(2,2,2-trifluoroethoxysulfamoyl)-1H-pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn[nH]c1S(=O)(=O)NOCC(F)(F)F |
| InChI | InChI=1S/C6H6F3N3O5S/c7-6(8,9)2-17-12-18(15,16)4-3(5(13)14)1-10-11-4/h1,12H,2H2,(H,10,11)(H,13,14) |
| InChIKey | HDDBWOCTXBGICH-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|