About N-methoxy-4,4-dimethylthian-3-amine
N-methoxy-4,4-dimethylthian-3-amine (PubChem CID 82706103) has the molecular formula C8H17NOS
and a molecular weight of 175.30 g/mol. Its IUPAC name is N-methoxy-4,4-dimethylthian-3-amine.
Molecular Properties
| Compound Name | N-methoxy-4,4-dimethylthian-3-amine |
| PubChem CID | 82706103 |
| Molecular Formula | C8H17NOS |
| Molecular Weight | 175.30 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | N-methoxy-4,4-dimethylthian-3-amine |
| SMILES | CONC1CSCCC1(C)C |
| InChI | InChI=1S/C8H17NOS/c1-8(2)4-5-11-6-7(8)9-10-3/h7,9H,4-6H2,1-3H3 |
| InChIKey | SGDBKJFPXCZOAW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-4,4-dimethylthian-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-4,4-dimethylthian-3-amine?
The IUPAC name of N-methoxy-4,4-dimethylthian-3-amine (CID 82706103) is N-methoxy-4,4-dimethylthian-3-amine.
What is the SMILES notation for N-methoxy-4,4-dimethylthian-3-amine?
The canonical SMILES for N-methoxy-4,4-dimethylthian-3-amine is CONC1CSCCC1(C)C.
What is the InChIKey of N-methoxy-4,4-dimethylthian-3-amine?
The InChIKey is SGDBKJFPXCZOAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NOS/c1-8(2)4-5-11-6-7(8)9-10-3/h7,9H,4-6H2,1-3H3.
What are the key properties of N-methoxy-4,4-dimethylthian-3-amine?
N-methoxy-4,4-dimethylthian-3-amine has a molecular weight of 175.30 g/mol, XLogP of 1.67, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-4,4-dimethylthian-3-amine is sourced from PubChem (CID 82706103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).