About 4-(methoxyamino)-1-methyl-3,4-dihydroquinolin-2-one
4-(methoxyamino)-1-methyl-3,4-dihydroquinolin-2-one (PubChem CID 82706106) has the molecular formula C11H14N2O2
and a molecular weight of 206.25 g/mol. Its IUPAC name is 4-(methoxyamino)-1-methyl-3,4-dihydroquinolin-2-one.
Molecular Properties
| Compound Name | 4-(methoxyamino)-1-methyl-3,4-dihydroquinolin-2-one |
| PubChem CID | 82706106 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 4-(methoxyamino)-1-methyl-3,4-dihydroquinolin-2-one |
| SMILES | CONC1CC(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C11H14N2O2/c1-13-10-6-4-3-5-8(10)9(12-15-2)7-11(13)14/h3-6,9,12H,7H2,1-2H3 |
| InChIKey | OTWGQQHVAPMXHF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(methoxyamino)-1-methyl-3,4-dihydroquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(methoxyamino)-1-methyl-3,4-dihydroquinolin-2-one?
The IUPAC name of 4-(methoxyamino)-1-methyl-3,4-dihydroquinolin-2-one (CID 82706106) is 4-(methoxyamino)-1-methyl-3,4-dihydroquinolin-2-one.
What is the SMILES notation for 4-(methoxyamino)-1-methyl-3,4-dihydroquinolin-2-one?
The canonical SMILES for 4-(methoxyamino)-1-methyl-3,4-dihydroquinolin-2-one is CONC1CC(=O)N(C)c2ccccc21.
What is the InChIKey of 4-(methoxyamino)-1-methyl-3,4-dihydroquinolin-2-one?
The InChIKey is OTWGQQHVAPMXHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2/c1-13-10-6-4-3-5-8(10)9(12-15-2)7-11(13)14/h3-6,9,12H,7H2,1-2H3.
What are the key properties of 4-(methoxyamino)-1-methyl-3,4-dihydroquinolin-2-one?
4-(methoxyamino)-1-methyl-3,4-dihydroquinolin-2-one has a molecular weight of 206.25 g/mol, XLogP of 1.25, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methoxyamino)-1-methyl-3,4-dihydroquinolin-2-one is sourced from PubChem (CID 82706106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).