C14H10BrF2NO — CID 82706445
N-(2-bromo-5-methylphenyl)-2,4-difluorobenzamide (PubChem CID 82706445) has the molecular formula C14H10BrF2NO and a molecular weight of 326.14 g/mol. Its IUPAC name is N-(2-bromo-5-methylphenyl)-2,4-difluorobenzamide.
| Compound Name | N-(2-bromo-5-methylphenyl)-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 82706445 |
| Molecular Formula | C14H10BrF2NO |
| Molecular Weight | 326.14 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | N-(2-bromo-5-methylphenyl)-2,4-difluorobenzamide |
| SMILES | Cc1ccc(Br)c(NC(=O)c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C14H10BrF2NO/c1-8-2-5-11(15)13(6-8)18-14(19)10-4-3-9(16)7-12(10)17/h2-7H,1H3,(H,18,19) |
| InChIKey | GHFYNHWPRQPXBV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.14 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |