C8H10F3N3O5S — CID 82706762
ethyl 5-(2,2,2-trifluoroethoxysulfamoyl)-1H-pyrazole-4-carboxylate (PubChem CID 82706762) has the molecular formula C8H10F3N3O5S and a molecular weight of 317.25 g/mol. Its IUPAC name is ethyl 5-(2,2,2-trifluoroethoxysulfamoyl)-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-(2,2,2-trifluoroethoxysulfamoyl)-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 82706762 |
| Molecular Formula | C8H10F3N3O5S |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | ethyl 5-(2,2,2-trifluoroethoxysulfamoyl)-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1S(=O)(=O)NOCC(F)(F)F |
| InChI | InChI=1S/C8H10F3N3O5S/c1-2-18-7(15)5-3-12-13-6(5)20(16,17)14-19-4-8(9,10)11/h3,14H,2,4H2,1H3,(H,12,13) |
| InChIKey | OYJYWICDFLTRNL-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|