C8H8F3NO5S2 — CID 82707235
3-methyl-5-(2,2,2-trifluoroethoxysulfamoyl)thiophene-2-carboxylic acid (PubChem CID 82707235) has the molecular formula C8H8F3NO5S2 and a molecular weight of 319.28 g/mol. Its IUPAC name is 3-methyl-5-(2,2,2-trifluoroethoxysulfamoyl)thiophene-2-carboxylic acid.
| Compound Name | 3-methyl-5-(2,2,2-trifluoroethoxysulfamoyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 82707235 |
| Molecular Formula | C8H8F3NO5S2 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 318.98 |
| IUPAC Name | 3-methyl-5-(2,2,2-trifluoroethoxysulfamoyl)thiophene-2-carboxylic acid |
| SMILES | Cc1cc(S(=O)(=O)NOCC(F)(F)F)sc1C(=O)O |
| InChI | InChI=1S/C8H8F3NO5S2/c1-4-2-5(18-6(4)7(13)14)19(15,16)12-17-3-8(9,10)11/h2,12H,3H2,1H3,(H,13,14) |
| InChIKey | JCLZASNQVXSHHK-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|