About 5H-thieno[2,3-c][2]benzothiepin-10-one
5H-thieno[2,3-c][2]benzothiepin-10-one (PubChem CID 827078) has the molecular formula C12H8OS2
and a molecular weight of 232.33 g/mol. Its IUPAC name is 5H-thieno[2,3-c][2]benzothiepin-10-one.
Molecular Properties
| Compound Name | 5H-thieno[2,3-c][2]benzothiepin-10-one |
| PubChem CID | 827078 |
| Molecular Formula | C12H8OS2 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.00 |
| IUPAC Name | 5H-thieno[2,3-c][2]benzothiepin-10-one |
| SMILES | O=C1c2ccccc2CSc2sccc21 |
| InChI | InChI=1S/C12H8OS2/c13-11-9-4-2-1-3-8(9)7-15-12-10(11)5-6-14-12/h1-6H,7H2 |
| InChIKey | FHHAGNSMAZXQMA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5H-thieno[2,3-c][2]benzothiepin-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-thieno[2,3-c][2]benzothiepin-10-one?
The IUPAC name of 5H-thieno[2,3-c][2]benzothiepin-10-one (CID 827078) is 5H-thieno[2,3-c][2]benzothiepin-10-one.
What is the SMILES notation for 5H-thieno[2,3-c][2]benzothiepin-10-one?
The canonical SMILES for 5H-thieno[2,3-c][2]benzothiepin-10-one is O=C1c2ccccc2CSc2sccc21.
What is the InChIKey of 5H-thieno[2,3-c][2]benzothiepin-10-one?
The InChIKey is FHHAGNSMAZXQMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8OS2/c13-11-9-4-2-1-3-8(9)7-15-12-10(11)5-6-14-12/h1-6H,7H2.
What are the key properties of 5H-thieno[2,3-c][2]benzothiepin-10-one?
5H-thieno[2,3-c][2]benzothiepin-10-one has a molecular weight of 232.33 g/mol, XLogP of 3.58, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-thieno[2,3-c][2]benzothiepin-10-one is sourced from PubChem (CID 827078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).