About 5-bromo-2-(3,4-dihydro-2H-chromen-4-ylamino)benzonitrile
5-bromo-2-(3,4-dihydro-2H-chromen-4-ylamino)benzonitrile (PubChem CID 82707909) has the molecular formula C16H13BrN2O
and a molecular weight of 329.20 g/mol. Its IUPAC name is 5-bromo-2-(3,4-dihydro-2H-chromen-4-ylamino)benzonitrile.
Molecular Properties
| Compound Name | 5-bromo-2-(3,4-dihydro-2H-chromen-4-ylamino)benzonitrile |
| PubChem CID | 82707909 |
| Molecular Formula | C16H13BrN2O |
| Molecular Weight | 329.20 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 5-bromo-2-(3,4-dihydro-2H-chromen-4-ylamino)benzonitrile |
| SMILES | N#Cc1cc(Br)ccc1NC1CCOc2ccccc21 |
| InChI | InChI=1S/C16H13BrN2O/c17-12-5-6-14(11(9-12)10-18)19-15-7-8-20-16-4-2-1-3-13(15)16/h1-6,9,15,19H,7-8H2 |
| InChIKey | HMFKJGGUYZHCGQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.20 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-2-(3,4-dihydro-2H-chromen-4-ylamino)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(3,4-dihydro-2H-chromen-4-ylamino)benzonitrile?
The IUPAC name of 5-bromo-2-(3,4-dihydro-2H-chromen-4-ylamino)benzonitrile (CID 82707909) is 5-bromo-2-(3,4-dihydro-2H-chromen-4-ylamino)benzonitrile.
What is the SMILES notation for 5-bromo-2-(3,4-dihydro-2H-chromen-4-ylamino)benzonitrile?
The canonical SMILES for 5-bromo-2-(3,4-dihydro-2H-chromen-4-ylamino)benzonitrile is N#Cc1cc(Br)ccc1NC1CCOc2ccccc21.
What is the InChIKey of 5-bromo-2-(3,4-dihydro-2H-chromen-4-ylamino)benzonitrile?
The InChIKey is HMFKJGGUYZHCGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13BrN2O/c17-12-5-6-14(11(9-12)10-18)19-15-7-8-20-16-4-2-1-3-13(15)16/h1-6,9,15,19H,7-8H2.
What are the key properties of 5-bromo-2-(3,4-dihydro-2H-chromen-4-ylamino)benzonitrile?
5-bromo-2-(3,4-dihydro-2H-chromen-4-ylamino)benzonitrile has a molecular weight of 329.20 g/mol, XLogP of 4.26, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(3,4-dihydro-2H-chromen-4-ylamino)benzonitrile is sourced from PubChem (CID 82707909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).