C12H11BrN4 — CID 82708500
5-bromo-2-[(5-methyl-1H-pyrazol-4-yl)methylamino]benzonitrile (PubChem CID 82708500) has the molecular formula C12H11BrN4 and a molecular weight of 291.15 g/mol. Its IUPAC name is 5-bromo-2-[(5-methyl-1H-pyrazol-4-yl)methylamino]benzonitrile.
| Compound Name | 5-bromo-2-[(5-methyl-1H-pyrazol-4-yl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 82708500 |
| Molecular Formula | C12H11BrN4 |
| Molecular Weight | 291.15 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 5-bromo-2-[(5-methyl-1H-pyrazol-4-yl)methylamino]benzonitrile |
| SMILES | Cc1[nH]ncc1CNc1ccc(Br)cc1C#N |
| InChI | InChI=1S/C12H11BrN4/c1-8-10(7-16-17-8)6-15-12-3-2-11(13)4-9(12)5-14/h2-4,7,15H,6H2,1H3,(H,16,17) |
| InChIKey | CHCNXMAZIZXIMG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.15 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |