About N-(2-methylpropoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine
N-(2-methylpropoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine (PubChem CID 82708999) has the molecular formula C12H22N2O
and a molecular weight of 210.32 g/mol. Its IUPAC name is N-(2-methylpropoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine.
Molecular Properties
| Compound Name | N-(2-methylpropoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine |
| PubChem CID | 82708999 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | N-(2-methylpropoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine |
| SMILES | Cc1cc(CNOCC(C)C)c(C)n1C |
| InChI | InChI=1S/C12H22N2O/c1-9(2)8-15-13-7-12-6-10(3)14(5)11(12)4/h6,9,13H,7-8H2,1-5H3 |
| InChIKey | OPEIQYGTYOWVDL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methylpropoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methylpropoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine?
The IUPAC name of N-(2-methylpropoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine (CID 82708999) is N-(2-methylpropoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine.
What is the SMILES notation for N-(2-methylpropoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine?
The canonical SMILES for N-(2-methylpropoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine is Cc1cc(CNOCC(C)C)c(C)n1C.
What is the InChIKey of N-(2-methylpropoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine?
The InChIKey is OPEIQYGTYOWVDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O/c1-9(2)8-15-13-7-12-6-10(3)14(5)11(12)4/h6,9,13H,7-8H2,1-5H3.
What are the key properties of N-(2-methylpropoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine?
N-(2-methylpropoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine has a molecular weight of 210.32 g/mol, XLogP of 2.32, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methylpropoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine is sourced from PubChem (CID 82708999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).