C15H13ClS — CID 827096
(11S)-11-chloro-2-methyl-6,11-dihydrobenzo[c][1]benzothiepine (PubChem CID 827096) has the molecular formula C15H13ClS and a molecular weight of 260.79 g/mol. Its IUPAC name is (11S)-11-chloro-2-methyl-6,11-dihydrobenzo[c][1]benzothiepine.
| Compound Name | (11S)-11-chloro-2-methyl-6,11-dihydrobenzo[c][1]benzothiepine |
|---|---|
| PubChem CID | 827096 |
| Molecular Formula | C15H13ClS |
| Molecular Weight | 260.79 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | (11S)-11-chloro-2-methyl-6,11-dihydrobenzo[c][1]benzothiepine |
| SMILES | Cc1ccc2c(c1)[C@@H](Cl)c1ccccc1CS2 |
| InChI | InChI=1S/C15H13ClS/c1-10-6-7-14-13(8-10)15(16)12-5-3-2-4-11(12)9-17-14/h2-8,15H,9H2,1H3/t15-/m0/s1 |
| InChIKey | WEKWAWSGOFOARR-HNNXBMFYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.79 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|