C14H9N3S — CID 827102
13-thia-2,4,5-triazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,5,7,9,11,14,16-octaene (PubChem CID 827102) has the molecular formula C14H9N3S and a molecular weight of 251.31 g/mol. Its IUPAC name is 13-thia-2,4,5-triazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,5,7,9,11,14,16-octaene.
| Compound Name | 13-thia-2,4,5-triazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,5,7,9,11,14,16-octaene |
|---|---|
| PubChem CID | 827102 |
| Molecular Formula | C14H9N3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 13-thia-2,4,5-triazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,5,7,9,11,14,16-octaene |
| SMILES | c1ccc2c(c1)Sc1ccccc1-n1cnnc1-2 |
| InChI | InChI=1S/C14H9N3S/c1-3-7-12-10(5-1)14-16-15-9-17(14)11-6-2-4-8-13(11)18-12/h1-9H |
| InChIKey | UYWXVAJGELGXNY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |