C9H16F3NOS — CID 82710643
5,5-dimethyl-N-(2,2,2-trifluoroethoxy)thian-3-amine (PubChem CID 82710643) has the molecular formula C9H16F3NOS and a molecular weight of 243.29 g/mol. Its IUPAC name is 5,5-dimethyl-N-(2,2,2-trifluoroethoxy)thian-3-amine.
| Compound Name | 5,5-dimethyl-N-(2,2,2-trifluoroethoxy)thian-3-amine |
|---|---|
| PubChem CID | 82710643 |
| Molecular Formula | C9H16F3NOS |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 5,5-dimethyl-N-(2,2,2-trifluoroethoxy)thian-3-amine |
| SMILES | CC1(C)CSCC(NOCC(F)(F)F)C1 |
| InChI | InChI=1S/C9H16F3NOS/c1-8(2)3-7(4-15-6-8)13-14-5-9(10,11)12/h7,13H,3-6H2,1-2H3 |
| InChIKey | JIBGULOPCLXHCU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|