C13H22N2O — CID 82710734
N,N-dimethyl-4-[(2-methylpropoxyamino)methyl]aniline (PubChem CID 82710734) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is N,N-dimethyl-4-[(2-methylpropoxyamino)methyl]aniline.
| Compound Name | N,N-dimethyl-4-[(2-methylpropoxyamino)methyl]aniline |
|---|---|
| PubChem CID | 82710734 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | N,N-dimethyl-4-[(2-methylpropoxyamino)methyl]aniline |
| SMILES | CC(C)CONCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C13H22N2O/c1-11(2)10-16-14-9-12-5-7-13(8-6-12)15(3)4/h5-8,11,14H,9-10H2,1-4H3 |
| InChIKey | JWQNMLXPGABRRO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|