C12H22N2OS — CID 82710745
1-(2-tert-butyl-1,3-thiazol-5-yl)-N-(2-methylpropoxy)methanamine (PubChem CID 82710745) has the molecular formula C12H22N2OS and a molecular weight of 242.39 g/mol. Its IUPAC name is 1-(2-tert-butyl-1,3-thiazol-5-yl)-N-(2-methylpropoxy)methanamine.
| Compound Name | 1-(2-tert-butyl-1,3-thiazol-5-yl)-N-(2-methylpropoxy)methanamine |
|---|---|
| PubChem CID | 82710745 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 1-(2-tert-butyl-1,3-thiazol-5-yl)-N-(2-methylpropoxy)methanamine |
| SMILES | CC(C)CONCc1cnc(C(C)(C)C)s1 |
| InChI | InChI=1S/C12H22N2OS/c1-9(2)8-15-14-7-10-6-13-11(16-10)12(3,4)5/h6,9,14H,7-8H2,1-5H3 |
| InChIKey | HUFHMGDPOYOMFC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|