C10H12F3N3OS — CID 82710800
1-(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-(2,2,2-trifluoroethoxy)methanamine (PubChem CID 82710800) has the molecular formula C10H12F3N3OS and a molecular weight of 279.29 g/mol. Its IUPAC name is 1-(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-(2,2,2-trifluoroethoxy)methanamine.
| Compound Name | 1-(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-(2,2,2-trifluoroethoxy)methanamine |
|---|---|
| PubChem CID | 82710800 |
| Molecular Formula | C10H12F3N3OS |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 1-(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-(2,2,2-trifluoroethoxy)methanamine |
| SMILES | Cc1nc2scc(C)n2c1CNOCC(F)(F)F |
| InChI | InChI=1S/C10H12F3N3OS/c1-6-4-18-9-15-7(2)8(16(6)9)3-14-17-5-10(11,12)13/h4,14H,3,5H2,1-2H3 |
| InChIKey | WOHSWHMFWXVQNN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|