C10H16F3N3O — CID 82710918
N-(2,2,2-trifluoroethoxy)-1-(1,3,5-trimethylpyrazol-4-yl)ethanamine (PubChem CID 82710918) has the molecular formula C10H16F3N3O and a molecular weight of 251.25 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethoxy)-1-(1,3,5-trimethylpyrazol-4-yl)ethanamine.
| Compound Name | N-(2,2,2-trifluoroethoxy)-1-(1,3,5-trimethylpyrazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 82710918 |
| Molecular Formula | C10H16F3N3O |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | N-(2,2,2-trifluoroethoxy)-1-(1,3,5-trimethylpyrazol-4-yl)ethanamine |
| SMILES | Cc1nn(C)c(C)c1C(C)NOCC(F)(F)F |
| InChI | InChI=1S/C10H16F3N3O/c1-6-9(8(3)16(4)14-6)7(2)15-17-5-10(11,12)13/h7,15H,5H2,1-4H3 |
| InChIKey | HJQLOAVFQYYQMF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|