C9H8Cl2F3NO — CID 82711093
1-(3,4-dichlorophenyl)-N-(2,2,2-trifluoroethoxy)methanamine (PubChem CID 82711093) has the molecular formula C9H8Cl2F3NO and a molecular weight of 274.07 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N-(2,2,2-trifluoroethoxy)methanamine.
| Compound Name | 1-(3,4-dichlorophenyl)-N-(2,2,2-trifluoroethoxy)methanamine |
|---|---|
| PubChem CID | 82711093 |
| Molecular Formula | C9H8Cl2F3NO |
| Molecular Weight | 274.07 g/mol |
| Exact Mass | 272.99 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N-(2,2,2-trifluoroethoxy)methanamine |
| SMILES | FC(F)(F)CONCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H8Cl2F3NO/c10-7-2-1-6(3-8(7)11)4-15-16-5-9(12,13)14/h1-3,15H,4-5H2 |
| InChIKey | LJAGFCPTTHVQIF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.07 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|