C9H7Cl3F3NO — CID 82711097
1-(2,3,6-trichlorophenyl)-N-(2,2,2-trifluoroethoxy)methanamine (PubChem CID 82711097) has the molecular formula C9H7Cl3F3NO and a molecular weight of 308.51 g/mol. Its IUPAC name is 1-(2,3,6-trichlorophenyl)-N-(2,2,2-trifluoroethoxy)methanamine.
| Compound Name | 1-(2,3,6-trichlorophenyl)-N-(2,2,2-trifluoroethoxy)methanamine |
|---|---|
| PubChem CID | 82711097 |
| Molecular Formula | C9H7Cl3F3NO |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 306.95 |
| IUPAC Name | 1-(2,3,6-trichlorophenyl)-N-(2,2,2-trifluoroethoxy)methanamine |
| SMILES | FC(F)(F)CONCc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C9H7Cl3F3NO/c10-6-1-2-7(11)8(12)5(6)3-16-17-4-9(13,14)15/h1-2,16H,3-4H2 |
| InChIKey | DBQHNCMGPNNELN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|