C13H23F3N2O3 — CID 82711430
tert-butyl N-[[2-(2,2,2-trifluoroethoxyamino)cyclopentyl]methyl]carbamate (PubChem CID 82711430) has the molecular formula C13H23F3N2O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is tert-butyl N-[[2-(2,2,2-trifluoroethoxyamino)cyclopentyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-(2,2,2-trifluoroethoxyamino)cyclopentyl]methyl]carbamate |
|---|---|
| PubChem CID | 82711430 |
| Molecular Formula | C13H23F3N2O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | tert-butyl N-[[2-(2,2,2-trifluoroethoxyamino)cyclopentyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCC1NOCC(F)(F)F |
| InChI | InChI=1S/C13H23F3N2O3/c1-12(2,3)21-11(19)17-7-9-5-4-6-10(9)18-20-8-13(14,15)16/h9-10,18H,4-8H2,1-3H3,(H,17,19) |
| InChIKey | RKYIPTDUCJAOSG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|