C10H11F3N4O — CID 82711445
1-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)-N-(2,2,2-trifluoroethoxy)methanamine (PubChem CID 82711445) has the molecular formula C10H11F3N4O and a molecular weight of 260.22 g/mol. Its IUPAC name is 1-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)-N-(2,2,2-trifluoroethoxy)methanamine.
| Compound Name | 1-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)-N-(2,2,2-trifluoroethoxy)methanamine |
|---|---|
| PubChem CID | 82711445 |
| Molecular Formula | C10H11F3N4O |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 1-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)-N-(2,2,2-trifluoroethoxy)methanamine |
| SMILES | Cc1cc2ncc(CNOCC(F)(F)F)cn2n1 |
| InChI | InChI=1S/C10H11F3N4O/c1-7-2-9-14-3-8(5-17(9)16-7)4-15-18-6-10(11,12)13/h2-3,5,15H,4,6H2,1H3 |
| InChIKey | FYPVSHJBSJFCOJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|