C12H13BrF3NO — CID 82711572
6-bromo-N-(2,2,2-trifluoroethoxy)-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 82711572) has the molecular formula C12H13BrF3NO and a molecular weight of 324.14 g/mol. Its IUPAC name is 6-bromo-N-(2,2,2-trifluoroethoxy)-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 6-bromo-N-(2,2,2-trifluoroethoxy)-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 82711572 |
| Molecular Formula | C12H13BrF3NO |
| Molecular Weight | 324.14 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 6-bromo-N-(2,2,2-trifluoroethoxy)-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | FC(F)(F)CONC1CCc2cc(Br)ccc2C1 |
| InChI | InChI=1S/C12H13BrF3NO/c13-10-3-1-9-6-11(4-2-8(9)5-10)17-18-7-12(14,15)16/h1,3,5,11,17H,2,4,6-7H2 |
| InChIKey | HDHIABFIHKTXDQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.14 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|