C11H14F3NO — CID 82711922
1-(2,4-dimethylphenyl)-N-(2,2,2-trifluoroethoxy)methanamine (PubChem CID 82711922) has the molecular formula C11H14F3NO and a molecular weight of 233.23 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-N-(2,2,2-trifluoroethoxy)methanamine.
| Compound Name | 1-(2,4-dimethylphenyl)-N-(2,2,2-trifluoroethoxy)methanamine |
|---|---|
| PubChem CID | 82711922 |
| Molecular Formula | C11H14F3NO |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-N-(2,2,2-trifluoroethoxy)methanamine |
| SMILES | Cc1ccc(CNOCC(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C11H14F3NO/c1-8-3-4-10(9(2)5-8)6-15-16-7-11(12,13)14/h3-5,15H,6-7H2,1-2H3 |
| InChIKey | JMLNQQIARQEHAD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|