About N-(2-methoxyethoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine
N-(2-methoxyethoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine (PubChem CID 82711962) has the molecular formula C11H20N2O2
and a molecular weight of 212.29 g/mol. Its IUPAC name is N-(2-methoxyethoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine.
Molecular Properties
| Compound Name | N-(2-methoxyethoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine |
| PubChem CID | 82711962 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | N-(2-methoxyethoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine |
| SMILES | COCCONCc1cc(C)n(C)c1C |
| InChI | InChI=1S/C11H20N2O2/c1-9-7-11(10(2)13(9)3)8-12-15-6-5-14-4/h7,12H,5-6,8H2,1-4H3 |
| InChIKey | OBDFQQUCVJCIAJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 35.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methoxyethoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyethoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine?
The IUPAC name of N-(2-methoxyethoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine (CID 82711962) is N-(2-methoxyethoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine.
What is the SMILES notation for N-(2-methoxyethoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine?
The canonical SMILES for N-(2-methoxyethoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine is COCCONCc1cc(C)n(C)c1C.
What is the InChIKey of N-(2-methoxyethoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine?
The InChIKey is OBDFQQUCVJCIAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O2/c1-9-7-11(10(2)13(9)3)8-12-15-6-5-14-4/h7,12H,5-6,8H2,1-4H3.
What are the key properties of N-(2-methoxyethoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine?
N-(2-methoxyethoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine has a molecular weight of 212.29 g/mol, XLogP of 1.31, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyethoxy)-1-(1,2,5-trimethylpyrrol-3-yl)methanamine is sourced from PubChem (CID 82711962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).