C12H19NO2 — CID 82712185
N-(2-methylpropoxy)-4,5,6,7-tetrahydro-1-benzofuran-4-amine (PubChem CID 82712185) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is N-(2-methylpropoxy)-4,5,6,7-tetrahydro-1-benzofuran-4-amine.
| Compound Name | N-(2-methylpropoxy)-4,5,6,7-tetrahydro-1-benzofuran-4-amine |
|---|---|
| PubChem CID | 82712185 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | N-(2-methylpropoxy)-4,5,6,7-tetrahydro-1-benzofuran-4-amine |
| SMILES | CC(C)CONC1CCCc2occc21 |
| InChI | InChI=1S/C12H19NO2/c1-9(2)8-15-13-11-4-3-5-12-10(11)6-7-14-12/h6-7,9,11,13H,3-5,8H2,1-2H3 |
| InChIKey | GICHLSKTBHNAEK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|