C12H22F3NO2 — CID 82712250
2,2-dimethyl-3-(2-methylpropoxy)-N-(2,2,2-trifluoroethoxy)cyclobutan-1-amine (PubChem CID 82712250) has the molecular formula C12H22F3NO2 and a molecular weight of 269.31 g/mol. Its IUPAC name is 2,2-dimethyl-3-(2-methylpropoxy)-N-(2,2,2-trifluoroethoxy)cyclobutan-1-amine.
| Compound Name | 2,2-dimethyl-3-(2-methylpropoxy)-N-(2,2,2-trifluoroethoxy)cyclobutan-1-amine |
|---|---|
| PubChem CID | 82712250 |
| Molecular Formula | C12H22F3NO2 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2,2-dimethyl-3-(2-methylpropoxy)-N-(2,2,2-trifluoroethoxy)cyclobutan-1-amine |
| SMILES | CC(C)COC1CC(NOCC(F)(F)F)C1(C)C |
| InChI | InChI=1S/C12H22F3NO2/c1-8(2)6-17-10-5-9(11(10,3)4)16-18-7-12(13,14)15/h8-10,16H,5-7H2,1-4H3 |
| InChIKey | UTFQHEWFLPERMJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|