About 1-(3-bromophenyl)-N-(2,2,2-trifluoroethoxy)methanamine
1-(3-bromophenyl)-N-(2,2,2-trifluoroethoxy)methanamine (PubChem CID 82712252) has the molecular formula C9H9BrF3NO
and a molecular weight of 284.07 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-(2,2,2-trifluoroethoxy)methanamine.
Molecular Properties
| Compound Name | 1-(3-bromophenyl)-N-(2,2,2-trifluoroethoxy)methanamine |
| PubChem CID | 82712252 |
| Molecular Formula | C9H9BrF3NO |
| Molecular Weight | 284.07 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | 1-(3-bromophenyl)-N-(2,2,2-trifluoroethoxy)methanamine |
| SMILES | FC(F)(F)CONCc1cccc(Br)c1 |
| InChI | InChI=1S/C9H9BrF3NO/c10-8-3-1-2-7(4-8)5-14-15-6-9(11,12)13/h1-4,14H,5-6H2 |
| InChIKey | YRDSEDYYYTUMFE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.07 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-bromophenyl)-N-(2,2,2-trifluoroethoxy)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-bromophenyl)-N-(2,2,2-trifluoroethoxy)methanamine?
The IUPAC name of 1-(3-bromophenyl)-N-(2,2,2-trifluoroethoxy)methanamine (CID 82712252) is 1-(3-bromophenyl)-N-(2,2,2-trifluoroethoxy)methanamine.
What is the SMILES notation for 1-(3-bromophenyl)-N-(2,2,2-trifluoroethoxy)methanamine?
The canonical SMILES for 1-(3-bromophenyl)-N-(2,2,2-trifluoroethoxy)methanamine is FC(F)(F)CONCc1cccc(Br)c1.
What is the InChIKey of 1-(3-bromophenyl)-N-(2,2,2-trifluoroethoxy)methanamine?
The InChIKey is YRDSEDYYYTUMFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrF3NO/c10-8-3-1-2-7(4-8)5-14-15-6-9(11,12)13/h1-4,14H,5-6H2.
What are the key properties of 1-(3-bromophenyl)-N-(2,2,2-trifluoroethoxy)methanamine?
1-(3-bromophenyl)-N-(2,2,2-trifluoroethoxy)methanamine has a molecular weight of 284.07 g/mol, XLogP of 3.03, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-bromophenyl)-N-(2,2,2-trifluoroethoxy)methanamine is sourced from PubChem (CID 82712252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).