C11H23NO2 — CID 82712267
N-(2-methoxyethoxy)-2,5-dimethylcyclohexan-1-amine (PubChem CID 82712267) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is N-(2-methoxyethoxy)-2,5-dimethylcyclohexan-1-amine.
| Compound Name | N-(2-methoxyethoxy)-2,5-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 82712267 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | N-(2-methoxyethoxy)-2,5-dimethylcyclohexan-1-amine |
| SMILES | COCCONC1CC(C)CCC1C |
| InChI | InChI=1S/C11H23NO2/c1-9-4-5-10(2)11(8-9)12-14-7-6-13-3/h9-12H,4-8H2,1-3H3 |
| InChIKey | LLHMGDCOTINBHA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|