About N-[2-[(2,2,2-trifluoroethoxyamino)methyl]thiophen-3-yl]acetamide
N-[2-[(2,2,2-trifluoroethoxyamino)methyl]thiophen-3-yl]acetamide (PubChem CID 82712398) has the molecular formula C9H11F3N2O2S
and a molecular weight of 268.26 g/mol. Its IUPAC name is N-[2-[(2,2,2-trifluoroethoxyamino)methyl]thiophen-3-yl]acetamide.
Molecular Properties
| Compound Name | N-[2-[(2,2,2-trifluoroethoxyamino)methyl]thiophen-3-yl]acetamide |
| PubChem CID | 82712398 |
| Molecular Formula | C9H11F3N2O2S |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | N-[2-[(2,2,2-trifluoroethoxyamino)methyl]thiophen-3-yl]acetamide |
| SMILES | CC(=O)Nc1ccsc1CNOCC(F)(F)F |
| InChI | InChI=1S/C9H11F3N2O2S/c1-6(15)14-7-2-3-17-8(7)4-13-16-5-9(10,11)12/h2-3,13H,4-5H2,1H3,(H,14,15) |
| InChIKey | QUFACJRNNPOMEQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(2,2,2-trifluoroethoxyamino)methyl]thiophen-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(2,2,2-trifluoroethoxyamino)methyl]thiophen-3-yl]acetamide?
The IUPAC name of N-[2-[(2,2,2-trifluoroethoxyamino)methyl]thiophen-3-yl]acetamide (CID 82712398) is N-[2-[(2,2,2-trifluoroethoxyamino)methyl]thiophen-3-yl]acetamide.
What is the SMILES notation for N-[2-[(2,2,2-trifluoroethoxyamino)methyl]thiophen-3-yl]acetamide?
The canonical SMILES for N-[2-[(2,2,2-trifluoroethoxyamino)methyl]thiophen-3-yl]acetamide is CC(=O)Nc1ccsc1CNOCC(F)(F)F.
What is the InChIKey of N-[2-[(2,2,2-trifluoroethoxyamino)methyl]thiophen-3-yl]acetamide?
The InChIKey is QUFACJRNNPOMEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3N2O2S/c1-6(15)14-7-2-3-17-8(7)4-13-16-5-9(10,11)12/h2-3,13H,4-5H2,1H3,(H,14,15).
What are the key properties of N-[2-[(2,2,2-trifluoroethoxyamino)methyl]thiophen-3-yl]acetamide?
N-[2-[(2,2,2-trifluoroethoxyamino)methyl]thiophen-3-yl]acetamide has a molecular weight of 268.26 g/mol, XLogP of 2.29, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(2,2,2-trifluoroethoxyamino)methyl]thiophen-3-yl]acetamide is sourced from PubChem (CID 82712398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).