C9H15N3O — CID 82713453
5-[[(2R)-2-methylpiperazin-1-yl]methyl]-1,2-oxazole (PubChem CID 82713453) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 5-[[(2R)-2-methylpiperazin-1-yl]methyl]-1,2-oxazole.
| Compound Name | 5-[[(2R)-2-methylpiperazin-1-yl]methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 82713453 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 5-[[(2R)-2-methylpiperazin-1-yl]methyl]-1,2-oxazole |
| SMILES | C[C@@H]1CNCCN1Cc1ccno1 |
| InChI | InChI=1S/C9H15N3O/c1-8-6-10-4-5-12(8)7-9-2-3-11-13-9/h2-3,8,10H,4-7H2,1H3/t8-/m1/s1 |
| InChIKey | OMUOYPDRLQYPLK-MRVPVSSYSA-N |
| XLogP | 0.47 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |