C10H12F3NO6S — CID 82714441
methyl 2,5-dimethyl-4-(2,2,2-trifluoroethoxysulfamoyl)furan-3-carboxylate (PubChem CID 82714441) has the molecular formula C10H12F3NO6S and a molecular weight of 331.27 g/mol. Its IUPAC name is methyl 2,5-dimethyl-4-(2,2,2-trifluoroethoxysulfamoyl)furan-3-carboxylate.
| Compound Name | methyl 2,5-dimethyl-4-(2,2,2-trifluoroethoxysulfamoyl)furan-3-carboxylate |
|---|---|
| PubChem CID | 82714441 |
| Molecular Formula | C10H12F3NO6S |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | methyl 2,5-dimethyl-4-(2,2,2-trifluoroethoxysulfamoyl)furan-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc(C)c1S(=O)(=O)NOCC(F)(F)F |
| InChI | InChI=1S/C10H12F3NO6S/c1-5-7(9(15)18-3)8(6(2)20-5)21(16,17)14-19-4-10(11,12)13/h14H,4H2,1-3H3 |
| InChIKey | JNBGHUZXWFRJGD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|