C13H21NO3 — CID 82714769
N-(2-methoxyethoxy)-1-(3-propan-2-yloxyphenyl)methanamine (PubChem CID 82714769) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is N-(2-methoxyethoxy)-1-(3-propan-2-yloxyphenyl)methanamine.
| Compound Name | N-(2-methoxyethoxy)-1-(3-propan-2-yloxyphenyl)methanamine |
|---|---|
| PubChem CID | 82714769 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | N-(2-methoxyethoxy)-1-(3-propan-2-yloxyphenyl)methanamine |
| SMILES | COCCONCc1cccc(OC(C)C)c1 |
| InChI | InChI=1S/C13H21NO3/c1-11(2)17-13-6-4-5-12(9-13)10-14-16-8-7-15-3/h4-6,9,11,14H,7-8,10H2,1-3H3 |
| InChIKey | GLRSGOXJOBRTSN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|