C6H6F3N3O5S — CID 82715370
2,4-dioxo-N-(2,2,2-trifluoroethoxy)-1H-pyrimidine-5-sulfonamide (PubChem CID 82715370) has the molecular formula C6H6F3N3O5S and a molecular weight of 289.19 g/mol. Its IUPAC name is 2,4-dioxo-N-(2,2,2-trifluoroethoxy)-1H-pyrimidine-5-sulfonamide.
| Compound Name | 2,4-dioxo-N-(2,2,2-trifluoroethoxy)-1H-pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 82715370 |
| Molecular Formula | C6H6F3N3O5S |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | 2,4-dioxo-N-(2,2,2-trifluoroethoxy)-1H-pyrimidine-5-sulfonamide |
| SMILES | O=c1[nH]cc(S(=O)(=O)NOCC(F)(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C6H6F3N3O5S/c7-6(8,9)2-17-12-18(15,16)3-1-10-5(14)11-4(3)13/h1,12H,2H2,(H2,10,11,13,14) |
| InChIKey | JIJITQXUEVEXPR-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|