C11H11F3N2O4S — CID 82715676
3-methyl-2-oxo-N-(2,2,2-trifluoroethoxy)-1,3-dihydroindole-5-sulfonamide (PubChem CID 82715676) has the molecular formula C11H11F3N2O4S and a molecular weight of 324.28 g/mol. Its IUPAC name is 3-methyl-2-oxo-N-(2,2,2-trifluoroethoxy)-1,3-dihydroindole-5-sulfonamide.
| Compound Name | 3-methyl-2-oxo-N-(2,2,2-trifluoroethoxy)-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 82715676 |
| Molecular Formula | C11H11F3N2O4S |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 3-methyl-2-oxo-N-(2,2,2-trifluoroethoxy)-1,3-dihydroindole-5-sulfonamide |
| SMILES | CC1C(=O)Nc2ccc(S(=O)(=O)NOCC(F)(F)F)cc21 |
| InChI | InChI=1S/C11H11F3N2O4S/c1-6-8-4-7(2-3-9(8)15-10(6)17)21(18,19)16-20-5-11(12,13)14/h2-4,6,16H,5H2,1H3,(H,15,17) |
| InChIKey | PXGMRUCWOSHDBY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|