C10H9F3N2O4S — CID 82715697
2-oxo-N-(2,2,2-trifluoroethoxy)-1,3-dihydroindole-5-sulfonamide (PubChem CID 82715697) has the molecular formula C10H9F3N2O4S and a molecular weight of 310.25 g/mol. Its IUPAC name is 2-oxo-N-(2,2,2-trifluoroethoxy)-1,3-dihydroindole-5-sulfonamide.
| Compound Name | 2-oxo-N-(2,2,2-trifluoroethoxy)-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 82715697 |
| Molecular Formula | C10H9F3N2O4S |
| Molecular Weight | 310.25 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 2-oxo-N-(2,2,2-trifluoroethoxy)-1,3-dihydroindole-5-sulfonamide |
| SMILES | O=C1Cc2cc(S(=O)(=O)NOCC(F)(F)F)ccc2N1 |
| InChI | InChI=1S/C10H9F3N2O4S/c11-10(12,13)5-19-15-20(17,18)7-1-2-8-6(3-7)4-9(16)14-8/h1-3,15H,4-5H2,(H,14,16) |
| InChIKey | ICLGHYMRPOJHAX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|