C7H10F3N3O3S — CID 82715699
2-ethyl-N-(2,2,2-trifluoroethoxy)-1H-imidazole-5-sulfonamide (PubChem CID 82715699) has the molecular formula C7H10F3N3O3S and a molecular weight of 273.24 g/mol. Its IUPAC name is 2-ethyl-N-(2,2,2-trifluoroethoxy)-1H-imidazole-5-sulfonamide.
| Compound Name | 2-ethyl-N-(2,2,2-trifluoroethoxy)-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 82715699 |
| Molecular Formula | C7H10F3N3O3S |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 2-ethyl-N-(2,2,2-trifluoroethoxy)-1H-imidazole-5-sulfonamide |
| SMILES | CCc1ncc(S(=O)(=O)NOCC(F)(F)F)[nH]1 |
| InChI | InChI=1S/C7H10F3N3O3S/c1-2-5-11-3-6(12-5)17(14,15)13-16-4-7(8,9)10/h3,13H,2,4H2,1H3,(H,11,12) |
| InChIKey | UPLQNPJJFMMCRR-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|