C8H10F3NO3S2 — CID 82715819
2,5-dimethyl-N-(2,2,2-trifluoroethoxy)thiophene-3-sulfonamide (PubChem CID 82715819) has the molecular formula C8H10F3NO3S2 and a molecular weight of 289.30 g/mol. Its IUPAC name is 2,5-dimethyl-N-(2,2,2-trifluoroethoxy)thiophene-3-sulfonamide.
| Compound Name | 2,5-dimethyl-N-(2,2,2-trifluoroethoxy)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 82715819 |
| Molecular Formula | C8H10F3NO3S2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 2,5-dimethyl-N-(2,2,2-trifluoroethoxy)thiophene-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NOCC(F)(F)F)c(C)s1 |
| InChI | InChI=1S/C8H10F3NO3S2/c1-5-3-7(6(2)16-5)17(13,14)12-15-4-8(9,10)11/h3,12H,4H2,1-2H3 |
| InChIKey | VVGQUHOUHMZABK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|