C11H13ClFNO2 — CID 82717073
7-chloro-8-fluoro-N-methoxy-2,3,4,5-tetrahydro-1-benzoxepin-5-amine (PubChem CID 82717073) has the molecular formula C11H13ClFNO2 and a molecular weight of 245.68 g/mol. Its IUPAC name is 7-chloro-8-fluoro-N-methoxy-2,3,4,5-tetrahydro-1-benzoxepin-5-amine.
| Compound Name | 7-chloro-8-fluoro-N-methoxy-2,3,4,5-tetrahydro-1-benzoxepin-5-amine |
|---|---|
| PubChem CID | 82717073 |
| Molecular Formula | C11H13ClFNO2 |
| Molecular Weight | 245.68 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 7-chloro-8-fluoro-N-methoxy-2,3,4,5-tetrahydro-1-benzoxepin-5-amine |
| SMILES | CONC1CCCOc2cc(F)c(Cl)cc21 |
| InChI | InChI=1S/C11H13ClFNO2/c1-15-14-10-3-2-4-16-11-6-9(13)8(12)5-7(10)11/h5-6,10,14H,2-4H2,1H3 |
| InChIKey | IZNAIYVCERMOSY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.68 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|